Balance this equation pb(no3)2+na2(cro4)=pb(cto4)+na(no3)

3 answers
Question:

Balance this equation
pb(no3)2+na2(cro4)=pb(cto4)+na(no3)

Answers

I'm guessing you mean Cr (Chromium) in the product instead of Ct.

Pb(NO3)2 + Na2(CrO4) = Pb(CtO4) + 2Na(NO3)

the right answer is c i just did the question.

Deposition  is  change of state has the wrong energy change listed 

Similar Solved Works

4 answers

Can you pls answer this question if you are Ethiopian.​

Can you pls answer this question if you are Ethiopian.​ [tex]Can you pls answer this question if you are Ethiopian.​[/tex]...
3 answers

You are studying a transport molecule. it appears to bind temporarily to the molecule to be transported.

You are studying a transport molecule. it appears to bind temporarily to the molecule to be transported. during normal transport, no energy is expended. the addition of a particular molecule that closely resembles the normally transported molecule inhibits transport. an increase in the concentration...
3 answers

Two waves were analyzed with some high-tech instrumentation. The first wave was found to have a wavelength of 3 x 10 m and

Two waves were analyzed with some high-tech instrumentation. The first wave was found to have a wavelength of 3 x 10 m and the second wave had a wavelength of 3 x 10 m. Which wave would have a higher frequency? Explain​...
9 answers

What is the best definition of an example paragraph?A. A topic that makes the reader want an example to know what'sgoing onB. A paragraph

What is the best definition of an example paragraph? A. A topic that makes the reader want an example to know what's going on B. A paragraph that introduces a subject in the topic sentence and gives three examples of the subject in the body C. A paragraph that introduces a topic and offers an examp...
10 answers

Where does photosynthesis occur?

Where does photosynthesis occur? [tex]Where does photosynthesis occur?[/tex]...
4 answers

Use the picture above i need answering this questions

Use the picture above i need answering this questions [tex]Use the picture above i need answering this questions[/tex]...
3 answers

Write out a brief conversation between you and a clothing store employee in which you tell him or her

Write out a brief conversation between you and a clothing store employee in which you tell him or her what you're looking for, including the color and size, and then buy it....
5 answers

Which conflict does the narrator face in this passage?O character vs. character, because his father's

Which conflict does the narrator face in this passage? O character vs. character, because his father's words cause him to question his actions character vs. nature, because he must battle the elements of weather O character vs. self, because he is struggling to understand how the gods lived O chara...
3 answers

A metal cube with a negative charge -Q_1−Q1​ minus, Q, start subscript, 1, end subscript is brought into contact with a cylinder

A metal cube with a negative charge -Q_1−Q 1 ​ minus, Q, start subscript, 1, end subscript is brought into contact with a cylinder of a negative charge -Q_2−Q 2 ​ minus, Q, start subscript, 2, end subscript, where |Q_1| > |Q_2|∣Q 1 ​ ∣>∣Q 2 ​ ∣vertical bar, Q, start...
10 answers

Describe how the people of France referred to Louis-Philippe. WILL MARK BRAINLIEST PLZ ANSWER QUICK

Describe how the people of France referred to Louis-Philippe. WILL MARK BRAINLIEST PLZ ANSWER QUICK...
4 answers

Id 428 303 6421password NVA37njust bored

Id 428 303 6421 password NVA37n just bored...
10 answers

In what way did the political situation in vietnam resemble that of korea in the 1950s? a) both vietnam

In what way did the political situation in vietnam resemble that of korea in the 1950s? a) both vietnam and korea were allied with the united states but then shifted allegiance to the soviet union. b) both vietnam and korea were unified, communist countries who then voted to become democracies. c) ...
10 answers

How did the United States' entry into World War II affect American society? It caused the majority of citizens to become suspicious

How did the United States' entry into World War II affect American society? It caused the majority of citizens to become suspicious of U. S. government actions. It caused a number of anti-war protests to take place across the United States. It increased the employment rate for African Americans and ...
4 answers

The solution set for |2x - 1| = 15 is {8} {-8, 8} {-7, 8}

The solution set for |2x - 1| = 15 is {8} {-8, 8} {-7, 8}...
6 answers

Is the following statement true or false? the topic sentence of a paragraph should indicate

Is the following statement true or false? the topic sentence of a paragraph should indicate what the paragraph is going to be about. false true...
3 answers

What is the geometric mean of 99 and 11

What is the geometric mean of 99 and 11...
2 answers

Currently Ark is charged $3,144,267 Depreciation on the Income Statement of Andrews. Andrews is planning for an increase in this

Currently Ark is charged $3,144,267 Depreciation on the Income Statement of Andrews. Andrews is planning for an increase in this depreciation. On the financial statements of Andrews will this...
12 answers

Two 15 N forces in same directions are acting on an object. What is the magnitude of the net force?

Two 15 N forces in same directions are acting on an object. What is the magnitude of the net force?...
10 answers

During an experiment a thermometer was placed in a beaker containing hydrogen peroxide. The following observations were recorded

During an experiment a thermometer was placed in a beaker containing hydrogen peroxide. The following observations were recorded when yeast granules were added to hydrogen peroxide. Observation 1: Fizzing and bubbling took place. Observation 2: The temperature began to rise. Based on the observation...
4 answers

How can entry level jobs be beneficial for workers in the hospitality industry​

How can entry level jobs be beneficial for workers in the hospitality industry​...

-- 0.013062--